About sodium;3H-2-benzofuran-1-one;chloride
sodium;3H-2-benzofuran-1-one;chloride (PubChem CID 174937502) has the molecular formula C8H6ClNaO2
and a molecular weight of 192.58 g/mol. Its IUPAC name is sodium;3H-2-benzofuran-1-one;chloride.
Molecular Properties
| Compound Name | sodium;3H-2-benzofuran-1-one;chloride |
| PubChem CID | 174937502 |
| Molecular Formula | C8H6ClNaO2 |
| Molecular Weight | 192.58 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | sodium;3H-2-benzofuran-1-one;chloride |
| SMILES | O=C1OCc2ccccc21.[Cl-].[Na+] |
| InChI | InChI=1S/C8H6O2.ClH.Na/c9-8-7-4-2-1-3-6(7)5-10-8;;/h1-4H,5H2;1H;/q;;+1/p-1 |
| InChIKey | ABRRJDKFOHSLHL-UHFFFAOYSA-M |
| XLogP | -4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.58 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;3H-2-benzofuran-1-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3H-2-benzofuran-1-one;chloride?
The IUPAC name of sodium;3H-2-benzofuran-1-one;chloride (CID 174937502) is sodium;3H-2-benzofuran-1-one;chloride.
What is the SMILES notation for sodium;3H-2-benzofuran-1-one;chloride?
The canonical SMILES for sodium;3H-2-benzofuran-1-one;chloride is O=C1OCc2ccccc21.[Cl-].[Na+].
What is the InChIKey of sodium;3H-2-benzofuran-1-one;chloride?
The InChIKey is ABRRJDKFOHSLHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O2.ClH.Na/c9-8-7-4-2-1-3-6(7)5-10-8;;/h1-4H,5H2;1H;/q;;+1/p-1.
What are the key properties of sodium;3H-2-benzofuran-1-one;chloride?
sodium;3H-2-benzofuran-1-one;chloride has a molecular weight of 192.58 g/mol, XLogP of -4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3H-2-benzofuran-1-one;chloride is sourced from PubChem (CID 174937502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).