About 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane
2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane (PubChem CID 174937572) has the molecular formula C5H12N2O6S
and a molecular weight of 228.23 g/mol. Its IUPAC name is 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane.
Molecular Properties
| Compound Name | 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane |
| PubChem CID | 174937572 |
| Molecular Formula | C5H12N2O6S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane |
| SMILES | COC(CN(C(=O)ON)S(=O)O)OC |
| InChI | InChI=1S/C5H12N2O6S/c1-11-4(12-2)3-7(14(9)10)5(8)13-6/h4H,3,6H2,1-2H3,(H,9,10) |
| InChIKey | OURJWOBKENZBCL-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane?
The IUPAC name of 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane (CID 174937572) is 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane.
What is the SMILES notation for 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane?
The canonical SMILES for 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane is COC(CN(C(=O)ON)S(=O)O)OC.
What is the InChIKey of 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane?
The InChIKey is OURJWOBKENZBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O6S/c1-11-4(12-2)3-7(14(9)10)5(8)13-6/h4H,3,6H2,1-2H3,(H,9,10).
What are the key properties of 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane?
2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane has a molecular weight of 228.23 g/mol, XLogP of -0.95, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[aminooxycarbonyl(sulfino)amino]-1,1-dimethoxyethane is sourced from PubChem (CID 174937572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).