C25H24N2O2 — CID 174937811
2-[[4-[[4-(2-pyridin-3-ylethynyl)phenoxy]methyl]phenyl]methyl]morpholine (PubChem CID 174937811) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[[4-[[4-(2-pyridin-3-ylethynyl)phenoxy]methyl]phenyl]methyl]morpholine.
| Compound Name | 2-[[4-[[4-(2-pyridin-3-ylethynyl)phenoxy]methyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 174937811 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[[4-[[4-(2-pyridin-3-ylethynyl)phenoxy]methyl]phenyl]methyl]morpholine |
| SMILES | C(#Cc1cccnc1)c1ccc(OCc2ccc(CC3CNCCO3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-2-22(17-26-13-1)6-3-20-9-11-24(12-10-20)29-19-23-7-4-21(5-8-23)16-25-18-27-14-15-28-25/h1-2,4-5,7-13,17,25,27H,14-16,18-19H2 |
| InChIKey | QOLVLHSDILFFHN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|