About 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine
1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine (PubChem CID 174937822) has the molecular formula C10H25N3
and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine |
| PubChem CID | 174937822 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.NCC1(N)CCCC1 |
| InChI | InChI=1S/C6H14N2.C4H11N/c7-5-6(8)3-1-2-4-6;1-4(2,3)5/h1-5,7-8H2;5H2,1-3H3 |
| InChIKey | XGDAUDKPJVETBE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine?
The IUPAC name of 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine (CID 174937822) is 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine.
What is the SMILES notation for 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine?
The canonical SMILES for 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine is CC(C)(C)N.NCC1(N)CCCC1.
What is the InChIKey of 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine?
The InChIKey is XGDAUDKPJVETBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C4H11N/c7-5-6(8)3-1-2-4-6;1-4(2,3)5/h1-5,7-8H2;5H2,1-3H3.
What are the key properties of 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine?
1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine has a molecular weight of 187.33 g/mol, XLogP of 0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)cyclopentan-1-amine;2-methylpropan-2-amine is sourced from PubChem (CID 174937822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).