About 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine
2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine (PubChem CID 174938150) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine.
Molecular Properties
| Compound Name | 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine |
| PubChem CID | 174938150 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine |
| SMILES | CC[C@]1(N=C(N)N)C=CC=CC1 |
| InChI | InChI=1S/C9H15N3/c1-2-9(12-8(10)11)6-4-3-5-7-9/h3-6H,2,7H2,1H3,(H4,10,11,12)/t9-/m0/s1 |
| InChIKey | NBRNTKPXBOOZCB-VIFPVBQESA-N |
| XLogP | 0.92 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine?
The IUPAC name of 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine (CID 174938150) is 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine.
What is the SMILES notation for 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine?
The canonical SMILES for 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine is CC[C@]1(N=C(N)N)C=CC=CC1.
What is the InChIKey of 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine?
The InChIKey is NBRNTKPXBOOZCB-VIFPVBQESA-N. The full InChI is InChI=1S/C9H15N3/c1-2-9(12-8(10)11)6-4-3-5-7-9/h3-6H,2,7H2,1H3,(H4,10,11,12)/t9-/m0/s1.
What are the key properties of 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine?
2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine has a molecular weight of 165.24 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]guanidine is sourced from PubChem (CID 174938150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).