About acetic acid;1,2,4-trimethylimidazole
acetic acid;1,2,4-trimethylimidazole (PubChem CID 174938383) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is acetic acid;1,2,4-trimethylimidazole.
Molecular Properties
| Compound Name | acetic acid;1,2,4-trimethylimidazole |
| PubChem CID | 174938383 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | acetic acid;1,2,4-trimethylimidazole |
| SMILES | CC(=O)O.Cc1cn(C)c(C)n1 |
| InChI | InChI=1S/C6H10N2.C2H4O2/c1-5-4-8(3)6(2)7-5;1-2(3)4/h4H,1-3H3;1H3,(H,3,4) |
| InChIKey | ZNSCTGWKVMCXJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;1,2,4-trimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1,2,4-trimethylimidazole?
The IUPAC name of acetic acid;1,2,4-trimethylimidazole (CID 174938383) is acetic acid;1,2,4-trimethylimidazole.
What is the SMILES notation for acetic acid;1,2,4-trimethylimidazole?
The canonical SMILES for acetic acid;1,2,4-trimethylimidazole is CC(=O)O.Cc1cn(C)c(C)n1.
What is the InChIKey of acetic acid;1,2,4-trimethylimidazole?
The InChIKey is ZNSCTGWKVMCXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H4O2/c1-5-4-8(3)6(2)7-5;1-2(3)4/h4H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;1,2,4-trimethylimidazole?
acetic acid;1,2,4-trimethylimidazole has a molecular weight of 170.21 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,2,4-trimethylimidazole is sourced from PubChem (CID 174938383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).