About CID 174938559
CID 174938559 (PubChem CID 174938559) has the molecular formula C17H20N4O6Se
and a molecular weight of 455.33 g/mol.
Molecular Properties
| Compound Name | CID 174938559 |
| PubChem CID | 174938559 |
| Molecular Formula | C17H20N4O6Se |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | — |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C.[Se] |
| InChI | InChI=1S/C17H20N4O6.Se/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15;/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27);/t11-,12+,14-;/m0./s1 |
| InChIKey | RHKLTIOKQNNNLZ-BMZHGHOISA-N |
| XLogP | -2.10 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174938559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174938559?
The IUPAC name of CID 174938559 (CID 174938559) is not available.
What is the SMILES notation for CID 174938559?
The canonical SMILES for CID 174938559 is Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C.[Se].
What is the InChIKey of CID 174938559?
The InChIKey is RHKLTIOKQNNNLZ-BMZHGHOISA-N. The full InChI is InChI=1S/C17H20N4O6.Se/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15;/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27);/t11-,12+,14-;/m0./s1.
What are the key properties of CID 174938559?
CID 174938559 has a molecular weight of 455.33 g/mol, XLogP of -2.10, 5 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174938559 is sourced from PubChem (CID 174938559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).