C11H11F11 — CID 174938660
6,6,7,7,8,8,9,9,10,10,10-undecafluoro-3-methyldec-2-ene (PubChem CID 174938660) has the molecular formula C11H11F11 and a molecular weight of 352.19 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,10-undecafluoro-3-methyldec-2-ene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,10-undecafluoro-3-methyldec-2-ene |
|---|---|
| PubChem CID | 174938660 |
| Molecular Formula | C11H11F11 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,10-undecafluoro-3-methyldec-2-ene |
| SMILES | CC=C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F11/c1-3-6(2)4-5-7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h3H,4-5H2,1-2H3 |
| InChIKey | ZXXSOMSTMCVVNK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|