About 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride
7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride (PubChem CID 174939516) has the molecular formula C7H5ClN4
and a molecular weight of 180.60 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride |
| PubChem CID | 174939516 |
| Molecular Formula | C7H5ClN4 |
| Molecular Weight | 180.60 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1c[nH]c2ncncc12 |
| InChI | InChI=1S/C7H4N4.ClH/c8-1-5-2-10-7-6(5)3-9-4-11-7;/h2-4H,(H,9,10,11);1H |
| InChIKey | LBQYTFZEZJNUCU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.60 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride?
The IUPAC name of 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride (CID 174939516) is 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride.
What is the SMILES notation for 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride?
The canonical SMILES for 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride is Cl.N#Cc1c[nH]c2ncncc12.
What is the InChIKey of 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride?
The InChIKey is LBQYTFZEZJNUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4.ClH/c8-1-5-2-10-7-6(5)3-9-4-11-7;/h2-4H,(H,9,10,11);1H.
What are the key properties of 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride?
7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride has a molecular weight of 180.60 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile;hydrochloride is sourced from PubChem (CID 174939516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).