C24H43NO7P+ — CID 174939606
2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione;trimethyl(2-phosphorosooxyethyl)azanium (PubChem CID 174939606) has the molecular formula C24H43NO7P+ and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione;trimethyl(2-phosphorosooxyethyl)azanium.
| Compound Name | 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione;trimethyl(2-phosphorosooxyethyl)azanium |
|---|---|
| PubChem CID | 174939606 |
| Molecular Formula | C24H43NO7P+ |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione;trimethyl(2-phosphorosooxyethyl)azanium |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCO)=C(C)C1=O.C[N+](C)(C)CCOP=O |
| InChI | InChI=1S/C19H30O5.C5H13NO2P/c1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21;1-6(2,3)4-5-8-9-7/h20H,4-13H2,1-3H3;4-5H2,1-3H3/q;+1 |
| InChIKey | CGXOTFIKDJJIOR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|