About ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide
ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 174939784) has the molecular formula C10H15F3N2O4S
and a molecular weight of 316.30 g/mol. Its IUPAC name is ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide |
| PubChem CID | 174939784 |
| Molecular Formula | C10H15F3N2O4S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc[nH]c1)C(F)(F)F.CCOC=O |
| InChI | InChI=1S/C7H9F3N2O2S.C3H6O2/c1-5(7(8,9)10)12-15(13,14)6-2-3-11-4-6;1-2-5-3-4/h2-5,11-12H,1H3;3H,2H2,1H3 |
| InChIKey | UOTGGLMKJMOYOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide?
The IUPAC name of ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide (CID 174939784) is ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide.
What is the SMILES notation for ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide?
The canonical SMILES for ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide is CC(NS(=O)(=O)c1cc[nH]c1)C(F)(F)F.CCOC=O.
What is the InChIKey of ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide?
The InChIKey is UOTGGLMKJMOYOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O2S.C3H6O2/c1-5(7(8,9)10)12-15(13,14)6-2-3-11-4-6;1-2-5-3-4/h2-5,11-12H,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide?
ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide has a molecular weight of 316.30 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;N-(1,1,1-trifluoropropan-2-yl)-1H-pyrrole-3-sulfonamide is sourced from PubChem (CID 174939784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).