About (2-aminophenyl)methyl hypofluorite
(2-aminophenyl)methyl hypofluorite (PubChem CID 174940511) has the molecular formula C7H8FNO
and a molecular weight of 141.14 g/mol. Its IUPAC name is (2-aminophenyl)methyl hypofluorite.
Molecular Properties
| Compound Name | (2-aminophenyl)methyl hypofluorite |
| PubChem CID | 174940511 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (2-aminophenyl)methyl hypofluorite |
| SMILES | Nc1ccccc1COF |
| InChI | InChI=1S/C7H8FNO/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5,9H2 |
| InChIKey | JLLZOROCZFARAL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)methyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)methyl hypofluorite?
The IUPAC name of (2-aminophenyl)methyl hypofluorite (CID 174940511) is (2-aminophenyl)methyl hypofluorite.
What is the SMILES notation for (2-aminophenyl)methyl hypofluorite?
The canonical SMILES for (2-aminophenyl)methyl hypofluorite is Nc1ccccc1COF.
What is the InChIKey of (2-aminophenyl)methyl hypofluorite?
The InChIKey is JLLZOROCZFARAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5,9H2.
What are the key properties of (2-aminophenyl)methyl hypofluorite?
(2-aminophenyl)methyl hypofluorite has a molecular weight of 141.14 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)methyl hypofluorite is sourced from PubChem (CID 174940511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).