About sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate
sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate (PubChem CID 174941326) has the molecular formula C9H18NaO5P
and a molecular weight of 260.20 g/mol. Its IUPAC name is sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate.
Molecular Properties
| Compound Name | sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate |
| PubChem CID | 174941326 |
| Molecular Formula | C9H18NaO5P |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate |
| SMILES | C=CC(=O)OP(=O)(OC)OCCCCC.[H-].[Na+] |
| InChI | InChI=1S/C9H17O5P.Na.H/c1-4-6-7-8-13-15(11,12-3)14-9(10)5-2;;/h5H,2,4,6-8H2,1,3H3;;/q;+1;-1 |
| InChIKey | OGSMPSMEONVLND-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate?
The IUPAC name of sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate (CID 174941326) is sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate.
What is the SMILES notation for sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate?
The canonical SMILES for sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate is C=CC(=O)OP(=O)(OC)OCCCCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate?
The InChIKey is OGSMPSMEONVLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O5P.Na.H/c1-4-6-7-8-13-15(11,12-3)14-9(10)5-2;;/h5H,2,4,6-8H2,1,3H3;;/q;+1;-1.
What are the key properties of sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate?
sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate has a molecular weight of 260.20 g/mol, XLogP of -0.21, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;[methoxy(pentoxy)phosphoryl] prop-2-enoate is sourced from PubChem (CID 174941326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).