About 1-octylpyrrolidin-2-one;tetradec-9-enoic acid
1-octylpyrrolidin-2-one;tetradec-9-enoic acid (PubChem CID 174941397) has the molecular formula C26H49NO3
and a molecular weight of 423.68 g/mol. Its IUPAC name is 1-octylpyrrolidin-2-one;tetradec-9-enoic acid.
Molecular Properties
| Compound Name | 1-octylpyrrolidin-2-one;tetradec-9-enoic acid |
| PubChem CID | 174941397 |
| Molecular Formula | C26H49NO3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.37 |
| IUPAC Name | 1-octylpyrrolidin-2-one;tetradec-9-enoic acid |
| SMILES | CCCCC=CCCCCCCCC(=O)O.CCCCCCCCN1CCCC1=O |
| InChI | InChI=1S/C14H26O2.C12H23NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-10-13-11-8-9-12(13)14/h5-6H,2-4,7-13H2,1H3,(H,15,16);2-11H2,1H3 |
| InChIKey | FMZJMLRLVVCWCK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-octylpyrrolidin-2-one;tetradec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylpyrrolidin-2-one;tetradec-9-enoic acid?
The IUPAC name of 1-octylpyrrolidin-2-one;tetradec-9-enoic acid (CID 174941397) is 1-octylpyrrolidin-2-one;tetradec-9-enoic acid.
What is the SMILES notation for 1-octylpyrrolidin-2-one;tetradec-9-enoic acid?
The canonical SMILES for 1-octylpyrrolidin-2-one;tetradec-9-enoic acid is CCCCC=CCCCCCCCC(=O)O.CCCCCCCCN1CCCC1=O.
What is the InChIKey of 1-octylpyrrolidin-2-one;tetradec-9-enoic acid?
The InChIKey is FMZJMLRLVVCWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2.C12H23NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4-5-6-7-10-13-11-8-9-12(13)14/h5-6H,2-4,7-13H2,1H3,(H,15,16);2-11H2,1H3.
What are the key properties of 1-octylpyrrolidin-2-one;tetradec-9-enoic acid?
1-octylpyrrolidin-2-one;tetradec-9-enoic acid has a molecular weight of 423.68 g/mol, XLogP of 7.52, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylpyrrolidin-2-one;tetradec-9-enoic acid is sourced from PubChem (CID 174941397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).