About 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one
1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one (PubChem CID 174941607) has the molecular formula C23H19F2NO2
and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one |
| PubChem CID | 174941607 |
| Molecular Formula | C23H19F2NO2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one |
| SMILES | C/C=C/C(=O)N1CC(=Cc2ccccc2F)C(=O)C(=Cc2ccccc2F)C1 |
| InChI | InChI=1S/C23H19F2NO2/c1-2-7-22(27)26-14-18(12-16-8-3-5-10-20(16)24)23(28)19(15-26)13-17-9-4-6-11-21(17)25/h2-13H,14-15H2,1H3/b7-2+,18-12?,19-13? |
| InChIKey | JPUXIKLAXKBHGP-GPLBNSJMSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one?
The IUPAC name of 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one (CID 174941607) is 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one.
What is the SMILES notation for 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one?
The canonical SMILES for 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one is C/C=C/C(=O)N1CC(=Cc2ccccc2F)C(=O)C(=Cc2ccccc2F)C1.
What is the InChIKey of 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one?
The InChIKey is JPUXIKLAXKBHGP-GPLBNSJMSA-N. The full InChI is InChI=1S/C23H19F2NO2/c1-2-7-22(27)26-14-18(12-16-8-3-5-10-20(16)24)23(28)19(15-26)13-17-9-4-6-11-21(17)25/h2-13H,14-15H2,1H3/b7-2+,18-12?,19-13?.
What are the key properties of 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one?
1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one has a molecular weight of 379.41 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-enoyl]-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one is sourced from PubChem (CID 174941607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).