About 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol
3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol (PubChem CID 174942560) has the molecular formula C10H20OSi
and a molecular weight of 184.35 g/mol. Its IUPAC name is 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol.
Molecular Properties
| Compound Name | 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol |
| PubChem CID | 174942560 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol |
| SMILES | CC#CC(O)([SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C10H20OSi/c1-7-8-10(11,12(5)6)9(2,3)4/h11-12H,1-6H3 |
| InChIKey | CCBLUHNRXLODOP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol?
The IUPAC name of 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol (CID 174942560) is 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol.
What is the SMILES notation for 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol?
The canonical SMILES for 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol is CC#CC(O)([SiH](C)C)C(C)(C)C.
What is the InChIKey of 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol?
The InChIKey is CCBLUHNRXLODOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OSi/c1-7-8-10(11,12(5)6)9(2,3)4/h11-12H,1-6H3.
What are the key properties of 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol?
3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol has a molecular weight of 184.35 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylsilyl-2,2-dimethylhex-4-yn-3-ol is sourced from PubChem (CID 174942560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).