C16H16ClF3N2 — CID 174942627
4-[(2-chlorophenyl)methyl]-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine (PubChem CID 174942627) has the molecular formula C16H16ClF3N2 and a molecular weight of 328.77 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine.
| Compound Name | 4-[(2-chlorophenyl)methyl]-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 174942627 |
| Molecular Formula | C16H16ClF3N2 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cc2ccccc2Cl)ccc1NCCC(F)(F)F |
| InChI | InChI=1S/C16H16ClF3N2/c17-13-4-2-1-3-12(13)9-11-5-6-15(14(21)10-11)22-8-7-16(18,19)20/h1-6,10,22H,7-9,21H2 |
| InChIKey | WRKZSODCDSMMOR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|