C18H27NO6 — CID 174943123
butyl prop-2-enoate;dimethyl 2-prop-2-enylpropanedioate;prop-2-enenitrile (PubChem CID 174943123) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is butyl prop-2-enoate;dimethyl 2-prop-2-enylpropanedioate;prop-2-enenitrile.
| Compound Name | butyl prop-2-enoate;dimethyl 2-prop-2-enylpropanedioate;prop-2-enenitrile |
|---|---|
| PubChem CID | 174943123 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | butyl prop-2-enoate;dimethyl 2-prop-2-enylpropanedioate;prop-2-enenitrile |
| SMILES | C=CC#N.C=CC(=O)OCCCC.C=CCC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C8H12O4.C7H12O2.C3H3N/c1-4-5-6(7(9)11-2)8(10)12-3;1-3-5-6-9-7(8)4-2;1-2-3-4/h4,6H,1,5H2,2-3H3;4H,2-3,5-6H2,1H3;2H,1H2 |
| InChIKey | CEGPDAYMADUTLB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|