C10H10Cl3NO2 — CID 174943316
1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid;hydrochloride (PubChem CID 174943316) has the molecular formula C10H10Cl3NO2 and a molecular weight of 282.55 g/mol. Its IUPAC name is 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid;hydrochloride.
| Compound Name | 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 174943316 |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.55 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 1,3-dichloro-1,2,3,7-tetrahydroisoquinoline-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1=C2C=CCC=C2C(Cl)NC1Cl |
| InChI | InChI=1S/C10H9Cl2NO2.ClH/c11-8-6-4-2-1-3-5(6)7(10(14)15)9(12)13-8;/h1,3-4,8-9,13H,2H2,(H,14,15);1H |
| InChIKey | MJHIAPPSSOTCJQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|