About bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile
bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile (PubChem CID 174943592) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile |
| PubChem CID | 174943592 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile |
| SMILES | N#CC1CO1.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C3H3NO/c1-2-5-4-6(5)3-1;4-1-3-2-5-3/h1-4H;3H,2H2 |
| InChIKey | XQCLBJJNVBZKCM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile (CID 174943592) is bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile is N#CC1CO1.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile?
The InChIKey is XQCLBJJNVBZKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C3H3NO/c1-2-5-4-6(5)3-1;4-1-3-2-5-3/h1-4H;3H,2H2.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile?
bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile has a molecular weight of 145.16 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;oxirane-2-carbonitrile is sourced from PubChem (CID 174943592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).