About N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine
N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine (PubChem CID 174943888) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine |
| PubChem CID | 174943888 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine |
| SMILES | NCCN(c1ccc[nH]1)N1CCCCC1 |
| InChI | InChI=1S/C11H20N4/c12-6-10-15(11-5-4-7-13-11)14-8-2-1-3-9-14/h4-5,7,13H,1-3,6,8-10,12H2 |
| InChIKey | BCHFXKFZOWIBSS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?
The IUPAC name of N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine (CID 174943888) is N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?
The canonical SMILES for N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine is NCCN(c1ccc[nH]1)N1CCCCC1.
What is the InChIKey of N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?
The InChIKey is BCHFXKFZOWIBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c12-6-10-15(11-5-4-7-13-11)14-8-2-1-3-9-14/h4-5,7,13H,1-3,6,8-10,12H2.
What are the key properties of N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?
N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine has a molecular weight of 208.31 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-piperidin-1-yl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 174943888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).