About CID 174944384
CID 174944384 (PubChem CID 174944384) has the molecular formula C2H8N3OSe
and a molecular weight of 169.07 g/mol.
Molecular Properties
| Compound Name | CID 174944384 |
| PubChem CID | 174944384 |
| Molecular Formula | C2H8N3OSe |
| Molecular Weight | 169.07 g/mol |
| Exact Mass | 169.98 |
| IUPAC Name | — |
| SMILES | C=O.N.[H]/N=C(/N)[Se] |
| InChI | InChI=1S/CH3N2Se.CH2O.H3N/c2-1(3)4;1-2;/h(H3,2,3);1H2;1H3 |
| InChIKey | PIDGKXDMCUJQME-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.07 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174944384 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174944384?
The IUPAC name of CID 174944384 (CID 174944384) is not available.
What is the SMILES notation for CID 174944384?
The canonical SMILES for CID 174944384 is C=O.N.[H]/N=C(/N)[Se].
What is the InChIKey of CID 174944384?
The InChIKey is PIDGKXDMCUJQME-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3N2Se.CH2O.H3N/c2-1(3)4;1-2;/h(H3,2,3);1H2;1H3.
What are the key properties of CID 174944384?
CID 174944384 has a molecular weight of 169.07 g/mol, XLogP of -0.97, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174944384 is sourced from PubChem (CID 174944384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).