C28H23N3O4 — CID 174944416
6-[4-(1-amino-2-oxobut-3-enyl)phenyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide (PubChem CID 174944416) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 6-[4-(1-amino-2-oxobut-3-enyl)phenyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-[4-(1-amino-2-oxobut-3-enyl)phenyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174944416 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 6-[4-(1-amino-2-oxobut-3-enyl)phenyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
| SMILES | C=CC(=O)C(N)c1ccc(-c2ccc(C(N)=O)c(Oc3ccc(Oc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C28H23N3O4/c1-2-25(32)26(29)19-10-8-18(9-11-19)24-17-16-23(27(30)33)28(31-24)35-22-14-12-21(13-15-22)34-20-6-4-3-5-7-20/h2-17,26H,1,29H2,(H2,30,33) |
| InChIKey | OQUNNWNYFCJXIN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|