About 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol
2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol (PubChem CID 174944550) has the molecular formula C10H20O5S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol.
Molecular Properties
| Compound Name | 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol |
| PubChem CID | 174944550 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol |
| SMILES | C1COC(C2COCCO2)CO1.OCCS |
| InChI | InChI=1S/C8H14O4.C2H6OS/c1-3-11-7(5-9-1)8-6-10-2-4-12-8;3-1-2-4/h7-8H,1-6H2;3-4H,1-2H2 |
| InChIKey | JSNUZRFPGLMEHV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol?
The IUPAC name of 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol (CID 174944550) is 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol.
What is the SMILES notation for 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol?
The canonical SMILES for 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol is C1COC(C2COCCO2)CO1.OCCS.
What is the InChIKey of 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol?
The InChIKey is JSNUZRFPGLMEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.C2H6OS/c1-3-11-7(5-9-1)8-6-10-2-4-12-8;3-1-2-4/h7-8H,1-6H2;3-4H,1-2H2.
What are the key properties of 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol?
2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol has a molecular weight of 252.33 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxan-2-yl)-1,4-dioxane;2-sulfanylethanol is sourced from PubChem (CID 174944550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).