About ethanol;5-nitro-1H-imidazole
ethanol;5-nitro-1H-imidazole (PubChem CID 174944765) has the molecular formula C5H9N3O3
and a molecular weight of 159.14 g/mol. Its IUPAC name is ethanol;5-nitro-1H-imidazole.
Molecular Properties
| Compound Name | ethanol;5-nitro-1H-imidazole |
| PubChem CID | 174944765 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | ethanol;5-nitro-1H-imidazole |
| SMILES | CCO.O=[N+]([O-])c1cnc[nH]1 |
| InChI | InChI=1S/C3H3N3O2.C2H6O/c7-6(8)3-1-4-2-5-3;1-2-3/h1-2H,(H,4,5);3H,2H2,1H3 |
| InChIKey | NXARQWNMUJIKGF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;5-nitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;5-nitro-1H-imidazole?
The IUPAC name of ethanol;5-nitro-1H-imidazole (CID 174944765) is ethanol;5-nitro-1H-imidazole.
What is the SMILES notation for ethanol;5-nitro-1H-imidazole?
The canonical SMILES for ethanol;5-nitro-1H-imidazole is CCO.O=[N+]([O-])c1cnc[nH]1.
What is the InChIKey of ethanol;5-nitro-1H-imidazole?
The InChIKey is NXARQWNMUJIKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2.C2H6O/c7-6(8)3-1-4-2-5-3;1-2-3/h1-2H,(H,4,5);3H,2H2,1H3.
What are the key properties of ethanol;5-nitro-1H-imidazole?
ethanol;5-nitro-1H-imidazole has a molecular weight of 159.14 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;5-nitro-1H-imidazole is sourced from PubChem (CID 174944765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).