About 1-bromo-2-phenylbenzene;oxolane
1-bromo-2-phenylbenzene;oxolane (PubChem CID 174944885) has the molecular formula C16H17BrO
and a molecular weight of 305.21 g/mol. Its IUPAC name is 1-bromo-2-phenylbenzene;oxolane.
Molecular Properties
| Compound Name | 1-bromo-2-phenylbenzene;oxolane |
| PubChem CID | 174944885 |
| Molecular Formula | C16H17BrO |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-bromo-2-phenylbenzene;oxolane |
| SMILES | Brc1ccccc1-c1ccccc1.C1CCOC1 |
| InChI | InChI=1S/C12H9Br.C4H8O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-4-5-3-1/h1-9H;1-4H2 |
| InChIKey | UTAQYVPIKKNKFQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-2-phenylbenzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-phenylbenzene;oxolane?
The IUPAC name of 1-bromo-2-phenylbenzene;oxolane (CID 174944885) is 1-bromo-2-phenylbenzene;oxolane.
What is the SMILES notation for 1-bromo-2-phenylbenzene;oxolane?
The canonical SMILES for 1-bromo-2-phenylbenzene;oxolane is Brc1ccccc1-c1ccccc1.C1CCOC1.
What is the InChIKey of 1-bromo-2-phenylbenzene;oxolane?
The InChIKey is UTAQYVPIKKNKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br.C4H8O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-4-5-3-1/h1-9H;1-4H2.
What are the key properties of 1-bromo-2-phenylbenzene;oxolane?
1-bromo-2-phenylbenzene;oxolane has a molecular weight of 305.21 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-phenylbenzene;oxolane is sourced from PubChem (CID 174944885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).