About 1-(1,3-dioxolan-2-yl)heptan-4-yl formate
1-(1,3-dioxolan-2-yl)heptan-4-yl formate (PubChem CID 174945908) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)heptan-4-yl formate.
Molecular Properties
| Compound Name | 1-(1,3-dioxolan-2-yl)heptan-4-yl formate |
| PubChem CID | 174945908 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)heptan-4-yl formate |
| SMILES | CCCC(CCCC1OCCO1)OC=O |
| InChI | InChI=1S/C11H20O4/c1-2-4-10(15-9-12)5-3-6-11-13-7-8-14-11/h9-11H,2-8H2,1H3 |
| InChIKey | NHBONINVCYEJRV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dioxolan-2-yl)heptan-4-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dioxolan-2-yl)heptan-4-yl formate?
The IUPAC name of 1-(1,3-dioxolan-2-yl)heptan-4-yl formate (CID 174945908) is 1-(1,3-dioxolan-2-yl)heptan-4-yl formate.
What is the SMILES notation for 1-(1,3-dioxolan-2-yl)heptan-4-yl formate?
The canonical SMILES for 1-(1,3-dioxolan-2-yl)heptan-4-yl formate is CCCC(CCCC1OCCO1)OC=O.
What is the InChIKey of 1-(1,3-dioxolan-2-yl)heptan-4-yl formate?
The InChIKey is NHBONINVCYEJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-4-10(15-9-12)5-3-6-11-13-7-8-14-11/h9-11H,2-8H2,1H3.
What are the key properties of 1-(1,3-dioxolan-2-yl)heptan-4-yl formate?
1-(1,3-dioxolan-2-yl)heptan-4-yl formate has a molecular weight of 216.28 g/mol, XLogP of 1.87, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dioxolan-2-yl)heptan-4-yl formate is sourced from PubChem (CID 174945908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).