About 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine
5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine (PubChem CID 174945955) has the molecular formula C19H20Br2N2S
and a molecular weight of 468.26 g/mol. Its IUPAC name is 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine.
Molecular Properties
| Compound Name | 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine |
| PubChem CID | 174945955 |
| Molecular Formula | C19H20Br2N2S |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine |
| SMILES | Brc1ccc2sccc2c1.Brc1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C11H15BrN2.C8H5BrS/c12-11-3-1-2-10(8-11)9-14-6-4-13-5-7-14;9-7-1-2-8-6(5-7)3-4-10-8/h1-3,8,13H,4-7,9H2;1-5H |
| InChIKey | VIDYJLMVEQWTMR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine?
The IUPAC name of 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine (CID 174945955) is 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine.
What is the SMILES notation for 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine?
The canonical SMILES for 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine is Brc1ccc2sccc2c1.Brc1cccc(CN2CCNCC2)c1.
What is the InChIKey of 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine?
The InChIKey is VIDYJLMVEQWTMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2.C8H5BrS/c12-11-3-1-2-10(8-11)9-14-6-4-13-5-7-14;9-7-1-2-8-6(5-7)3-4-10-8/h1-3,8,13H,4-7,9H2;1-5H.
What are the key properties of 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine?
5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine has a molecular weight of 468.26 g/mol, XLogP of 5.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-benzothiophene;1-[(3-bromophenyl)methyl]piperazine is sourced from PubChem (CID 174945955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).