About [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate
[4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate (PubChem CID 174946013) has the molecular formula C26H23N3O3
and a molecular weight of 425.49 g/mol. Its IUPAC name is [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate.
Molecular Properties
| Compound Name | [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate |
| PubChem CID | 174946013 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate |
| SMILES | CC(c1ccc(OC#N)cc1)c1ccc(OC#N)cc1.Cc1cc(C)c(OC#N)c(C)c1 |
| InChI | InChI=1S/C16H12N2O2.C10H11NO/c1-12(13-2-6-15(7-3-13)19-10-17)14-4-8-16(9-5-14)20-11-18;1-7-4-8(2)10(12-6-11)9(3)5-7/h2-9,12H,1H3;4-5H,1-3H3 |
| InChIKey | CIJYCNFDDDNQES-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate?
The IUPAC name of [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate (CID 174946013) is [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate.
What is the SMILES notation for [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate?
The canonical SMILES for [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate is CC(c1ccc(OC#N)cc1)c1ccc(OC#N)cc1.Cc1cc(C)c(OC#N)c(C)c1.
What is the InChIKey of [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate?
The InChIKey is CIJYCNFDDDNQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2.C10H11NO/c1-12(13-2-6-15(7-3-13)19-10-17)14-4-8-16(9-5-14)20-11-18;1-7-4-8(2)10(12-6-11)9(3)5-7/h2-9,12H,1H3;4-5H,1-3H3.
What are the key properties of [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate?
[4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate has a molecular weight of 425.49 g/mol, XLogP of 6.03, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate;(2,4,6-trimethylphenyl) cyanate is sourced from PubChem (CID 174946013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).