About 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde
2-fluoro-2,3-dihydroquinoline-4-carbaldehyde (PubChem CID 174946266) has the molecular formula C10H8FNO
and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde |
| PubChem CID | 174946266 |
| Molecular Formula | C10H8FNO |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde |
| SMILES | O=CC1=c2ccccc2=NC(F)C1 |
| InChI | InChI=1S/C10H8FNO/c11-10-5-7(6-13)8-3-1-2-4-9(8)12-10/h1-4,6,10H,5H2 |
| InChIKey | AOLWMAWHWFLIHM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde?
The IUPAC name of 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde (CID 174946266) is 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde.
What is the SMILES notation for 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde?
The canonical SMILES for 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde is O=CC1=c2ccccc2=NC(F)C1.
What is the InChIKey of 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde?
The InChIKey is AOLWMAWHWFLIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO/c11-10-5-7(6-13)8-3-1-2-4-9(8)12-10/h1-4,6,10H,5H2.
What are the key properties of 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde?
2-fluoro-2,3-dihydroquinoline-4-carbaldehyde has a molecular weight of 177.18 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2,3-dihydroquinoline-4-carbaldehyde is sourced from PubChem (CID 174946266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).