About 3-ethyl-2,3-dihydrophenanthrene
3-ethyl-2,3-dihydrophenanthrene (PubChem CID 174946736) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydrophenanthrene.
Molecular Properties
| Compound Name | 3-ethyl-2,3-dihydrophenanthrene |
| PubChem CID | 174946736 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-ethyl-2,3-dihydrophenanthrene |
| SMILES | CCC1C=c2c(ccc3ccccc23)=CC1 |
| InChI | InChI=1S/C16H16/c1-2-12-7-8-14-10-9-13-5-3-4-6-15(13)16(14)11-12/h3-6,8-12H,2,7H2,1H3 |
| InChIKey | UPQVIZXAEXKFMY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-2,3-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,3-dihydrophenanthrene?
The IUPAC name of 3-ethyl-2,3-dihydrophenanthrene (CID 174946736) is 3-ethyl-2,3-dihydrophenanthrene.
What is the SMILES notation for 3-ethyl-2,3-dihydrophenanthrene?
The canonical SMILES for 3-ethyl-2,3-dihydrophenanthrene is CCC1C=c2c(ccc3ccccc23)=CC1.
What is the InChIKey of 3-ethyl-2,3-dihydrophenanthrene?
The InChIKey is UPQVIZXAEXKFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-2-12-7-8-14-10-9-13-5-3-4-6-15(13)16(14)11-12/h3-6,8-12H,2,7H2,1H3.
What are the key properties of 3-ethyl-2,3-dihydrophenanthrene?
3-ethyl-2,3-dihydrophenanthrene has a molecular weight of 208.30 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,3-dihydrophenanthrene is sourced from PubChem (CID 174946736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).