About CID 174946982
CID 174946982 (PubChem CID 174946982) has the molecular formula C4H8BO2S
and a molecular weight of 130.99 g/mol.
Molecular Properties
| Compound Name | CID 174946982 |
| PubChem CID | 174946982 |
| Molecular Formula | C4H8BO2S |
| Molecular Weight | 130.99 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | — |
| SMILES | O=S1(=O)CCCC1.[B] |
| InChI | InChI=1S/C4H8O2S.B/c5-7(6)3-1-2-4-7;/h1-4H2; |
| InChIKey | SARWBRXJBFNFGJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.99 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174946982 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174946982?
The IUPAC name of CID 174946982 (CID 174946982) is not available.
What is the SMILES notation for CID 174946982?
The canonical SMILES for CID 174946982 is O=S1(=O)CCCC1.[B].
What is the InChIKey of CID 174946982?
The InChIKey is SARWBRXJBFNFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S.B/c5-7(6)3-1-2-4-7;/h1-4H2;.
What are the key properties of CID 174946982?
CID 174946982 has a molecular weight of 130.99 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174946982 is sourced from PubChem (CID 174946982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).