About (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline
(2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline (PubChem CID 174947086) has the molecular formula C15H16ClN2O4P
and a molecular weight of 354.73 g/mol. Its IUPAC name is (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline.
Molecular Properties
| Compound Name | (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline |
| PubChem CID | 174947086 |
| Molecular Formula | C15H16ClN2O4P |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline |
| SMILES | Cc1ccccc1N.O=P(O)(O)Oc1c(Cl)[nH]c2ccccc12 |
| InChI | InChI=1S/C8H7ClNO4P.C7H9N/c9-8-7(14-15(11,12)13)5-3-1-2-4-6(5)10-8;1-6-4-2-3-5-7(6)8/h1-4,10H,(H2,11,12,13);2-5H,8H2,1H3 |
| InChIKey | HPOMRWISAAZCRK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline?
The IUPAC name of (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline (CID 174947086) is (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline.
What is the SMILES notation for (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline?
The canonical SMILES for (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline is Cc1ccccc1N.O=P(O)(O)Oc1c(Cl)[nH]c2ccccc12.
What is the InChIKey of (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline?
The InChIKey is HPOMRWISAAZCRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClNO4P.C7H9N/c9-8-7(14-15(11,12)13)5-3-1-2-4-6(5)10-8;1-6-4-2-3-5-7(6)8/h1-4,10H,(H2,11,12,13);2-5H,8H2,1H3.
What are the key properties of (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline?
(2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline has a molecular weight of 354.73 g/mol, XLogP of 3.87, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1H-indol-3-yl) dihydrogen phosphate;2-methylaniline is sourced from PubChem (CID 174947086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).