C20H40O2 — CID 174947161
2-tert-butylperoxy-2-methylpropane;4,6,7,7-tetramethyloct-2-yne (PubChem CID 174947161) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;4,6,7,7-tetramethyloct-2-yne.
| Compound Name | 2-tert-butylperoxy-2-methylpropane;4,6,7,7-tetramethyloct-2-yne |
|---|---|
| PubChem CID | 174947161 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;4,6,7,7-tetramethyloct-2-yne |
| SMILES | CC#CC(C)CC(C)C(C)(C)C.CC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C12H22.C8H18O2/c1-7-8-10(2)9-11(3)12(4,5)6;1-7(2,3)9-10-8(4,5)6/h10-11H,9H2,1-6H3;1-6H3 |
| InChIKey | MFYZPSPIIBPMBE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|