About 4-ethyl-1H-azepine-2,6-diol
4-ethyl-1H-azepine-2,6-diol (PubChem CID 174947380) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-ethyl-1H-azepine-2,6-diol.
Molecular Properties
| Compound Name | 4-ethyl-1H-azepine-2,6-diol |
| PubChem CID | 174947380 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-ethyl-1H-azepine-2,6-diol |
| SMILES | CCC1=CC(O)=CNC(O)=C1 |
| InChI | InChI=1S/C8H11NO2/c1-2-6-3-7(10)5-9-8(11)4-6/h3-5,9-11H,2H2,1H3 |
| InChIKey | PTIUFDJGVCVDGB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-1H-azepine-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1H-azepine-2,6-diol?
The IUPAC name of 4-ethyl-1H-azepine-2,6-diol (CID 174947380) is 4-ethyl-1H-azepine-2,6-diol.
What is the SMILES notation for 4-ethyl-1H-azepine-2,6-diol?
The canonical SMILES for 4-ethyl-1H-azepine-2,6-diol is CCC1=CC(O)=CNC(O)=C1.
What is the InChIKey of 4-ethyl-1H-azepine-2,6-diol?
The InChIKey is PTIUFDJGVCVDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-2-6-3-7(10)5-9-8(11)4-6/h3-5,9-11H,2H2,1H3.
What are the key properties of 4-ethyl-1H-azepine-2,6-diol?
4-ethyl-1H-azepine-2,6-diol has a molecular weight of 153.18 g/mol, XLogP of 1.72, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1H-azepine-2,6-diol is sourced from PubChem (CID 174947380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).