About calcium;1,2,4,5-tetramethylbenzene;dichloride
calcium;1,2,4,5-tetramethylbenzene;dichloride (PubChem CID 174947669) has the molecular formula C10H14CaCl2
and a molecular weight of 245.21 g/mol. Its IUPAC name is calcium;1,2,4,5-tetramethylbenzene;dichloride.
Molecular Properties
| Compound Name | calcium;1,2,4,5-tetramethylbenzene;dichloride |
| PubChem CID | 174947669 |
| Molecular Formula | C10H14CaCl2 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | calcium;1,2,4,5-tetramethylbenzene;dichloride |
| SMILES | Cc1cc(C)c(C)cc1C.[Ca+2].[Cl-].[Cl-] |
| InChI | InChI=1S/C10H14.Ca.2ClH/c1-7-5-9(3)10(4)6-8(7)2;;;/h5-6H,1-4H3;;2*1H/q;+2;;/p-2 |
| InChIKey | IBBUKMFYQBRIHO-UHFFFAOYSA-L |
| XLogP | -3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze calcium;1,2,4,5-tetramethylbenzene;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;1,2,4,5-tetramethylbenzene;dichloride?
The IUPAC name of calcium;1,2,4,5-tetramethylbenzene;dichloride (CID 174947669) is calcium;1,2,4,5-tetramethylbenzene;dichloride.
What is the SMILES notation for calcium;1,2,4,5-tetramethylbenzene;dichloride?
The canonical SMILES for calcium;1,2,4,5-tetramethylbenzene;dichloride is Cc1cc(C)c(C)cc1C.[Ca+2].[Cl-].[Cl-].
What is the InChIKey of calcium;1,2,4,5-tetramethylbenzene;dichloride?
The InChIKey is IBBUKMFYQBRIHO-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14.Ca.2ClH/c1-7-5-9(3)10(4)6-8(7)2;;;/h5-6H,1-4H3;;2*1H/q;+2;;/p-2.
What are the key properties of calcium;1,2,4,5-tetramethylbenzene;dichloride?
calcium;1,2,4,5-tetramethylbenzene;dichloride has a molecular weight of 245.21 g/mol, XLogP of -3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;1,2,4,5-tetramethylbenzene;dichloride is sourced from PubChem (CID 174947669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).