C29H36O2S — CID 174948015
2,4-di(propan-2-yl)thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 174948015) has the molecular formula C29H36O2S and a molecular weight of 448.67 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 2,4-di(propan-2-yl)thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 174948015 |
| Molecular Formula | C29H36O2S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 2,4-di(propan-2-yl)thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC(C)c1cc(C(C)C)c2sc3ccccc3c(=O)c2c1.CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C19H20OS.C10H16O/c1-11(2)13-9-15(12(3)4)19-16(10-13)18(20)14-7-5-6-8-17(14)21-19;1-9(2)7-4-5-10(9,3)8(11)6-7/h5-12H,1-4H3;7H,4-6H2,1-3H3 |
| InChIKey | XUQVTHLPZTZIRA-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|