About 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole
2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole (PubChem CID 174948985) has the molecular formula C14H9F6N
and a molecular weight of 305.22 g/mol. Its IUPAC name is 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole.
Molecular Properties
| Compound Name | 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole |
| PubChem CID | 174948985 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole |
| SMILES | FC(F)(F)C1(C(F)(F)F)C=Cc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C14H9F6N/c15-13(16,17)12(14(18,19)20)6-5-9-8-3-1-2-4-10(8)21-11(9)7-12/h1-6,21H,7H2 |
| InChIKey | GZBJWLKOWFIQDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole?
The IUPAC name of 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole (CID 174948985) is 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole.
What is the SMILES notation for 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole?
The canonical SMILES for 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole is FC(F)(F)C1(C(F)(F)F)C=Cc2c([nH]c3ccccc23)C1.
What is the InChIKey of 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole?
The InChIKey is GZBJWLKOWFIQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6N/c15-13(16,17)12(14(18,19)20)6-5-9-8-3-1-2-4-10(8)21-11(9)7-12/h1-6,21H,7H2.
What are the key properties of 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole?
2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole has a molecular weight of 305.22 g/mol, XLogP of 4.85, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(trifluoromethyl)-1,9-dihydrocarbazole is sourced from PubChem (CID 174948985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).