About 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol
2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol (PubChem CID 174949127) has the molecular formula C13H24N6O2
and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol.
Molecular Properties
| Compound Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol |
| PubChem CID | 174949127 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol |
| SMILES | CC(O)Oc1ccccc1.NCCC/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C8H10O2.C5H14N6/c1-7(9)10-8-5-3-2-4-6-8;6-2-1-3-10-5(9)11-4(7)8/h2-7,9H,1H3;1-3,6H2,(H6,7,8,9,10,11) |
| InChIKey | JLOXXSTYISJVSD-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol?
The IUPAC name of 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol (CID 174949127) is 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol.
What is the SMILES notation for 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol?
The canonical SMILES for 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol is CC(O)Oc1ccccc1.NCCC/N=C(\N)N=C(N)N.
What is the InChIKey of 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol?
The InChIKey is JLOXXSTYISJVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C5H14N6/c1-7(9)10-8-5-3-2-4-6-8;6-2-1-3-10-5(9)11-4(7)8/h2-7,9H,1H3;1-3,6H2,(H6,7,8,9,10,11).
What are the key properties of 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol?
2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol has a molecular weight of 296.38 g/mol, XLogP of -0.67, 5 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;1-phenoxyethanol is sourced from PubChem (CID 174949127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).