About 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione
1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione (PubChem CID 174949176) has the molecular formula C30H21NO2Se2
and a molecular weight of 585.42 g/mol. Its IUPAC name is 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione |
| PubChem CID | 174949176 |
| Molecular Formula | C30H21NO2Se2 |
| Molecular Weight | 585.42 g/mol |
| Exact Mass | 586.99 |
| IUPAC Name | 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccccc1.c1ccc2c([Se][Se]c3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H14Se2.C10H7NO2/c1-3-11-17-15(7-1)9-5-13-19(17)21-22-20-14-6-10-16-8-2-4-12-18(16)20;12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h1-14H;1-7H |
| InChIKey | PXTUSAOYKFDYET-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione?
The IUPAC name of 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione (CID 174949176) is 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione.
What is the SMILES notation for 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione?
The canonical SMILES for 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione is O=C1C=CC(=O)N1c1ccccc1.c1ccc2c([Se][Se]c3cccc4ccccc34)cccc2c1.
What is the InChIKey of 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione?
The InChIKey is PXTUSAOYKFDYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Se2.C10H7NO2/c1-3-11-17-15(7-1)9-5-13-19(17)21-22-20-14-6-10-16-8-2-4-12-18(16)20;12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h1-14H;1-7H.
What are the key properties of 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione?
1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione has a molecular weight of 585.42 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(naphthalen-1-yldiselanyl)naphthalene;1-phenylpyrrole-2,5-dione is sourced from PubChem (CID 174949176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).