About 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole
4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole (PubChem CID 174949506) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole |
| PubChem CID | 174949506 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole |
| SMILES | CCCc1ccn(Cc2cnoc2)c1 |
| InChI | InChI=1S/C11H14N2O/c1-2-3-10-4-5-13(7-10)8-11-6-12-14-9-11/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | SATUJVRZVJSBRJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole?
The IUPAC name of 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole (CID 174949506) is 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole.
What is the SMILES notation for 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole?
The canonical SMILES for 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole is CCCc1ccn(Cc2cnoc2)c1.
What is the InChIKey of 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole?
The InChIKey is SATUJVRZVJSBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-2-3-10-4-5-13(7-10)8-11-6-12-14-9-11/h4-7,9H,2-3,8H2,1H3.
What are the key properties of 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole?
4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole has a molecular weight of 190.25 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-propylpyrrol-1-yl)methyl]-1,2-oxazole is sourced from PubChem (CID 174949506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).