About 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole
5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole (PubChem CID 174949576) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole.
Molecular Properties
| Compound Name | 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole |
| PubChem CID | 174949576 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole |
| SMILES | CC(C)(O)CCCC1=CCCCC1.c1cc[nH]c1 |
| InChI | InChI=1S/C12H22O.C4H5N/c1-12(2,13)10-6-9-11-7-4-3-5-8-11;1-2-4-5-3-1/h7,13H,3-6,8-10H2,1-2H3;1-5H |
| InChIKey | JVTDGNQZXUETGC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole?
The IUPAC name of 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole (CID 174949576) is 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole.
What is the SMILES notation for 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole?
The canonical SMILES for 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole is CC(C)(O)CCCC1=CCCCC1.c1cc[nH]c1.
What is the InChIKey of 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole?
The InChIKey is JVTDGNQZXUETGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C4H5N/c1-12(2,13)10-6-9-11-7-4-3-5-8-11;1-2-4-5-3-1/h7,13H,3-6,8-10H2,1-2H3;1-5H.
What are the key properties of 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole?
5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole has a molecular weight of 249.40 g/mol, XLogP of 4.44, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexen-1-yl)-2-methylpentan-2-ol;1H-pyrrole is sourced from PubChem (CID 174949576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).