About 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane
4,5-bis(ethenyl)-2-pentyl-1,3-dioxane (PubChem CID 174949620) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane |
| PubChem CID | 174949620 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane |
| SMILES | C=CC1COC(CCCCC)OC1C=C |
| InChI | InChI=1S/C13H22O2/c1-4-7-8-9-13-14-10-11(5-2)12(6-3)15-13/h5-6,11-13H,2-4,7-10H2,1H3 |
| InChIKey | BLCUEWVZUPYKFG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane?
The IUPAC name of 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane (CID 174949620) is 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane.
What is the SMILES notation for 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane?
The canonical SMILES for 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane is C=CC1COC(CCCCC)OC1C=C.
What is the InChIKey of 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane?
The InChIKey is BLCUEWVZUPYKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-4-7-8-9-13-14-10-11(5-2)12(6-3)15-13/h5-6,11-13H,2-4,7-10H2,1H3.
What are the key properties of 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane?
4,5-bis(ethenyl)-2-pentyl-1,3-dioxane has a molecular weight of 210.32 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-2-pentyl-1,3-dioxane is sourced from PubChem (CID 174949620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).