About 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile
1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile (PubChem CID 174949833) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile.
Molecular Properties
| Compound Name | 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile |
| PubChem CID | 174949833 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile |
| SMILES | C#N.NCc1ccccc1C1(N)CCC1 |
| InChI | InChI=1S/C11H16N2.CHN/c12-8-9-4-1-2-5-10(9)11(13)6-3-7-11;1-2/h1-2,4-5H,3,6-8,12-13H2;1H |
| InChIKey | RAZROOYNQFCWPT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile?
The IUPAC name of 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile (CID 174949833) is 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile.
What is the SMILES notation for 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile?
The canonical SMILES for 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile is C#N.NCc1ccccc1C1(N)CCC1.
What is the InChIKey of 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile?
The InChIKey is RAZROOYNQFCWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.CHN/c12-8-9-4-1-2-5-10(9)11(13)6-3-7-11;1-2/h1-2,4-5H,3,6-8,12-13H2;1H.
What are the key properties of 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile?
1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile has a molecular weight of 203.29 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(aminomethyl)phenyl]cyclobutan-1-amine;formonitrile is sourced from PubChem (CID 174949833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).