C40H61NO3 — CID 174949863
2-ethoxyquinoline;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol (PubChem CID 174949863) has the molecular formula C40H61NO3 and a molecular weight of 603.93 g/mol. Its IUPAC name is 2-ethoxyquinoline;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2-ethoxyquinoline;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 174949863 |
| Molecular Formula | C40H61NO3 |
| Molecular Weight | 603.93 g/mol |
| Exact Mass | 603.47 |
| IUPAC Name | 2-ethoxyquinoline;(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
| SMILES | CCOc1ccc2ccccc2n1.Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H50O2.C11H11NO/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29;1-2-13-11-8-7-9-5-3-4-6-10(9)12-11/h20-22,30H,9-19H2,1-8H3;3-8H,2H2,1H3/t21?,22?,29-;/m1./s1 |
| InChIKey | QTZOZXYNRNDXNG-FIICNZCFSA-N |
| XLogP | 11.47 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.93 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |