About 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine
5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine (PubChem CID 174950429) has the molecular formula C31H31NS
and a molecular weight of 449.66 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine |
| PubChem CID | 174950429 |
| Molecular Formula | C31H31NS |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine |
| SMILES | CC(C)(C)c1ccc(C2SCN(c3ccc(-c4ccccc4)cc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31NS/c1-31(2,3)27-18-14-26(15-19-27)30-29(25-12-8-5-9-13-25)32(22-33-30)28-20-16-24(17-21-28)23-10-6-4-7-11-23/h4-21,29-30H,22H2,1-3H3 |
| InChIKey | LTCVEFHLWLQTJM-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine?
The IUPAC name of 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine (CID 174950429) is 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine.
What is the SMILES notation for 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine?
The canonical SMILES for 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine is CC(C)(C)c1ccc(C2SCN(c3ccc(-c4ccccc4)cc3)C2c2ccccc2)cc1.
What is the InChIKey of 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine?
The InChIKey is LTCVEFHLWLQTJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H31NS/c1-31(2,3)27-18-14-26(15-19-27)30-29(25-12-8-5-9-13-25)32(22-33-30)28-20-16-24(17-21-28)23-10-6-4-7-11-23/h4-21,29-30H,22H2,1-3H3.
What are the key properties of 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine?
5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine has a molecular weight of 449.66 g/mol, XLogP of 8.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butylphenyl)-4-phenyl-3-(4-phenylphenyl)-1,3-thiazolidine is sourced from PubChem (CID 174950429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).