About 2-methyl-1H-imidazole;naphthalene-2,6-diamine
2-methyl-1H-imidazole;naphthalene-2,6-diamine (PubChem CID 174950702) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-methyl-1H-imidazole;naphthalene-2,6-diamine.
Molecular Properties
| Compound Name | 2-methyl-1H-imidazole;naphthalene-2,6-diamine |
| PubChem CID | 174950702 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-methyl-1H-imidazole;naphthalene-2,6-diamine |
| SMILES | Cc1ncc[nH]1.Nc1ccc2cc(N)ccc2c1 |
| InChI | InChI=1S/C10H10N2.C4H6N2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;1-4-5-2-3-6-4/h1-6H,11-12H2;2-3H,1H3,(H,5,6) |
| InChIKey | MMJRZRGAEXUJKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-imidazole;naphthalene-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-imidazole;naphthalene-2,6-diamine?
The IUPAC name of 2-methyl-1H-imidazole;naphthalene-2,6-diamine (CID 174950702) is 2-methyl-1H-imidazole;naphthalene-2,6-diamine.
What is the SMILES notation for 2-methyl-1H-imidazole;naphthalene-2,6-diamine?
The canonical SMILES for 2-methyl-1H-imidazole;naphthalene-2,6-diamine is Cc1ncc[nH]1.Nc1ccc2cc(N)ccc2c1.
What is the InChIKey of 2-methyl-1H-imidazole;naphthalene-2,6-diamine?
The InChIKey is MMJRZRGAEXUJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C4H6N2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;1-4-5-2-3-6-4/h1-6H,11-12H2;2-3H,1H3,(H,5,6).
What are the key properties of 2-methyl-1H-imidazole;naphthalene-2,6-diamine?
2-methyl-1H-imidazole;naphthalene-2,6-diamine has a molecular weight of 240.31 g/mol, XLogP of 2.72, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-imidazole;naphthalene-2,6-diamine is sourced from PubChem (CID 174950702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).