C18H17N3O3 — CID 174951191
5-[(2-amino-3-phenylpropanoyl)amino]-1H-indole-2-carboxylic acid (PubChem CID 174951191) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-[(2-amino-3-phenylpropanoyl)amino]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[(2-amino-3-phenylpropanoyl)amino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 174951191 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-[(2-amino-3-phenylpropanoyl)amino]-1H-indole-2-carboxylic acid |
| SMILES | NC(Cc1ccccc1)C(=O)Nc1ccc2[nH]c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C18H17N3O3/c19-14(8-11-4-2-1-3-5-11)17(22)20-13-6-7-15-12(9-13)10-16(21-15)18(23)24/h1-7,9-10,14,21H,8,19H2,(H,20,22)(H,23,24) |
| InChIKey | KTWJWZJZIFOZEN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |