C7H4F7N — CID 174951631
3-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrrole (PubChem CID 174951631) has the molecular formula C7H4F7N and a molecular weight of 235.10 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrrole.
| Compound Name | 3-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrrole |
|---|---|
| PubChem CID | 174951631 |
| Molecular Formula | C7H4F7N |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 3-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrrole |
| SMILES | FC(F)c1cc[nH]c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F7N/c8-5(9)3-1-2-15-4(3)6(10,11)7(12,13)14/h1-2,5,15H |
| InChIKey | ZQHNAVKASXYIIQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|