About gold;phenol
gold;phenol (PubChem CID 174951806) has the molecular formula C12H10AuO2-2
and a molecular weight of 383.18 g/mol. Its IUPAC name is gold;phenol.
Molecular Properties
| Compound Name | gold;phenol |
| PubChem CID | 174951806 |
| Molecular Formula | C12H10AuO2-2 |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | gold;phenol |
| SMILES | Oc1cc[c-]cc1.Oc1cc[c-]cc1.[Au] |
| InChI | InChI=1S/2C6H5O.Au/c2*7-6-4-2-1-3-5-6;/h2*2-5,7H;/q2*-1; |
| InChIKey | ZPZNILKUHDGGIZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze gold;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;phenol?
The IUPAC name of gold;phenol (CID 174951806) is gold;phenol.
What is the SMILES notation for gold;phenol?
The canonical SMILES for gold;phenol is Oc1cc[c-]cc1.Oc1cc[c-]cc1.[Au].
What is the InChIKey of gold;phenol?
The InChIKey is ZPZNILKUHDGGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5O.Au/c2*7-6-4-2-1-3-5-6;/h2*2-5,7H;/q2*-1;.
What are the key properties of gold;phenol?
gold;phenol has a molecular weight of 383.18 g/mol, XLogP of 2.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;phenol is sourced from PubChem (CID 174951806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).